About 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole
5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole (PubChem CID 11109980) has the molecular formula C22H25NO
and a molecular weight of 319.45 g/mol. Its IUPAC name is 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole.
Molecular Properties
| Compound Name | 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole |
| PubChem CID | 11109980 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole |
| SMILES | CCOC1=CC(C(C)(C)C)=NC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO/c1-5-24-20-16-19(21(2,3)4)23-22(20,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,5H2,1-4H3 |
| InChIKey | VLVKTEGBIPNPIK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole?
The IUPAC name of 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole (CID 11109980) is 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole.
What is the SMILES notation for 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole?
The canonical SMILES for 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole is CCOC1=CC(C(C)(C)C)=NC1(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole?
The InChIKey is VLVKTEGBIPNPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO/c1-5-24-20-16-19(21(2,3)4)23-22(20,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,5H2,1-4H3.
What are the key properties of 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole?
5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole has a molecular weight of 319.45 g/mol, XLogP of 5.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-ethoxy-2,2-diphenylpyrrole is sourced from PubChem (CID 11109980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).