C18H29IN4O4 — CID 111099979
tert-butyl 4-[N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111099979) has the molecular formula C18H29IN4O4 and a molecular weight of 492.36 g/mol. Its IUPAC name is tert-butyl 4-[N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111099979 |
| Molecular Formula | C18H29IN4O4 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | tert-butyl 4-[N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | COc1cccc(C/N=C(\N)N2CCN(C(=O)OC(C)(C)C)CC2)c1O.I |
| InChI | InChI=1S/C18H28N4O4.HI/c1-18(2,3)26-17(24)22-10-8-21(9-11-22)16(19)20-12-13-6-5-7-14(25-4)15(13)23;/h5-7,23H,8-12H2,1-4H3,(H2,19,20);1H |
| InChIKey | SDADQKYZGLSZNN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|