About 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile
2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile (PubChem CID 11110119) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile |
| PubChem CID | 11110119 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile |
| SMILES | N#CCN1COC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H12N2O/c12-6-7-13-9-14-8-11(13)10-4-2-1-3-5-10/h1-5,11H,7-9H2/t11-/m0/s1 |
| InChIKey | HCCRKULUUAPCGT-NSHDSACASA-N |
| XLogP | 1.54 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile?
The IUPAC name of 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile (CID 11110119) is 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile.
What is the SMILES notation for 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile?
The canonical SMILES for 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile is N#CCN1COC[C@H]1c1ccccc1.
What is the InChIKey of 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile?
The InChIKey is HCCRKULUUAPCGT-NSHDSACASA-N. The full InChI is InChI=1S/C11H12N2O/c12-6-7-13-9-14-8-11(13)10-4-2-1-3-5-10/h1-5,11H,7-9H2/t11-/m0/s1.
What are the key properties of 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile?
2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile has a molecular weight of 188.23 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile is sourced from PubChem (CID 11110119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).