C14H16N2O7 — CID 11110121
(5R,7R,8R,9R)-7-[(1R)-1,2-dihydroxyethyl]-8,9-dihydroxy-3-phenyl-6-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 11110121) has the molecular formula C14H16N2O7 and a molecular weight of 324.29 g/mol. Its IUPAC name is (5R,7R,8R,9R)-7-[(1R)-1,2-dihydroxyethyl]-8,9-dihydroxy-3-phenyl-6-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R,7R,8R,9R)-7-[(1R)-1,2-dihydroxyethyl]-8,9-dihydroxy-3-phenyl-6-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 11110121 |
| Molecular Formula | C14H16N2O7 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (5R,7R,8R,9R)-7-[(1R)-1,2-dihydroxyethyl]-8,9-dihydroxy-3-phenyl-6-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1N[C@]2(O[C@H]([C@H](O)CO)[C@H](O)[C@H]2O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O7/c17-6-8(18)10-9(19)11(20)14(23-10)12(21)16(13(22)15-14)7-4-2-1-3-5-7/h1-5,8-11,17-20H,6H2,(H,15,22)/t8-,9+,10-,11-,14-/m1/s1 |
| InChIKey | IMMACHAXHGOIND-AYDOGRCQSA-N |
| XLogP | -2.09 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|