C19H26IN3O — CID 111101250
1-(3-methoxyphenyl)-2-[2-methyl-2-(4-methylphenyl)propyl]guanidine;hydroiodide (PubChem CID 111101250) has the molecular formula C19H26IN3O and a molecular weight of 439.34 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[2-methyl-2-(4-methylphenyl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxyphenyl)-2-[2-methyl-2-(4-methylphenyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111101250 |
| Molecular Formula | C19H26IN3O |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[2-methyl-2-(4-methylphenyl)propyl]guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/CC(C)(C)c2ccc(C)cc2)c1.I |
| InChI | InChI=1S/C19H25N3O.HI/c1-14-8-10-15(11-9-14)19(2,3)13-21-18(20)22-16-6-5-7-17(12-16)23-4;/h5-12H,13H2,1-4H3,(H3,20,21,22);1H |
| InChIKey | HNHSKZBDGUXUHF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|