About 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine
1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine (PubChem CID 111101445) has the molecular formula C13H27N3
and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine.
Molecular Properties
| Compound Name | 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine |
| PubChem CID | 111101445 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NCCCCC(C)(C)C |
| InChI | InChI=1S/C13H27N3/c1-11(2)10-16-12(14)15-9-7-6-8-13(3,4)5/h1,6-10H2,2-5H3,(H3,14,15,16) |
| InChIKey | YCBLMAIPHRGLRM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine?
The IUPAC name of 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine (CID 111101445) is 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine.
What is the SMILES notation for 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine?
The canonical SMILES for 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine is C=C(C)C/N=C(\N)NCCCCC(C)(C)C.
What is the InChIKey of 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine?
The InChIKey is YCBLMAIPHRGLRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3/c1-11(2)10-16-12(14)15-9-7-6-8-13(3,4)5/h1,6-10H2,2-5H3,(H3,14,15,16).
What are the key properties of 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine?
1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine has a molecular weight of 225.38 g/mol, XLogP of 2.68, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-dimethylhexyl)-2-(2-methylprop-2-enyl)guanidine is sourced from PubChem (CID 111101445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).