C12H17N3O3 — CID 111101960
2-[2-(3-hydroxypiperidin-1-yl)-2-oxoethyl]-6-methylpyridazin-3-one (PubChem CID 111101960) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[2-(3-hydroxypiperidin-1-yl)-2-oxoethyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[2-(3-hydroxypiperidin-1-yl)-2-oxoethyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 111101960 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[2-(3-hydroxypiperidin-1-yl)-2-oxoethyl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(CC(=O)N2CCCC(O)C2)n1 |
| InChI | InChI=1S/C12H17N3O3/c1-9-4-5-11(17)15(13-9)8-12(18)14-6-2-3-10(16)7-14/h4-5,10,16H,2-3,6-8H2,1H3 |
| InChIKey | LXGSYIBLBGSBQK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |