C15H19N3O3 — CID 111102231
1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(2-hydroxy-3-phenylpropyl)urea (PubChem CID 111102231) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(2-hydroxy-3-phenylpropyl)urea.
| Compound Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(2-hydroxy-3-phenylpropyl)urea |
|---|---|
| PubChem CID | 111102231 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)-3-(2-hydroxy-3-phenylpropyl)urea |
| SMILES | Cc1nc(NC(=O)NCC(O)Cc2ccccc2)oc1C |
| InChI | InChI=1S/C15H19N3O3/c1-10-11(2)21-15(17-10)18-14(20)16-9-13(19)8-12-6-4-3-5-7-12/h3-7,13,19H,8-9H2,1-2H3,(H2,16,17,18,20) |
| InChIKey | ICARPHCXXSPOJT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |