About 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide
2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide (PubChem CID 111102359) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide |
| PubChem CID | 111102359 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide |
| SMILES | O=C1CCC(NC(=O)C(O)(c2ccccc2)c2ccccc2)CN1 |
| InChI | InChI=1S/C19H20N2O3/c22-17-12-11-16(13-20-17)21-18(23)19(24,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16,24H,11-13H2,(H,20,22)(H,21,23) |
| InChIKey | ANAOOGOXTIMJHN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide?
The IUPAC name of 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide (CID 111102359) is 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide.
What is the SMILES notation for 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide?
The canonical SMILES for 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide is O=C1CCC(NC(=O)C(O)(c2ccccc2)c2ccccc2)CN1.
What is the InChIKey of 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide?
The InChIKey is ANAOOGOXTIMJHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c22-17-12-11-16(13-20-17)21-18(23)19(24,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16,24H,11-13H2,(H,20,22)(H,21,23).
What are the key properties of 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide?
2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide has a molecular weight of 324.38 g/mol, XLogP of 1.32, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-(6-oxopiperidin-3-yl)-2,2-diphenylacetamide is sourced from PubChem (CID 111102359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).