C18H21NO2S — CID 111102637
N-(2-hydroxy-3-phenylpropyl)-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide (PubChem CID 111102637) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-(2-hydroxy-3-phenylpropyl)-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide.
| Compound Name | N-(2-hydroxy-3-phenylpropyl)-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 111102637 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-(2-hydroxy-3-phenylpropyl)-2-(5-methylthiophen-2-yl)cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(C2CC2C(=O)NCC(O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C18H21NO2S/c1-12-7-8-17(22-12)15-10-16(15)18(21)19-11-14(20)9-13-5-3-2-4-6-13/h2-8,14-16,20H,9-11H2,1H3,(H,19,21) |
| InChIKey | AIRNVFJCERQCJA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |