C14H13F3N2O4 — CID 11110305
(4R)-N-hydroxy-2-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 11110305) has the molecular formula C14H13F3N2O4 and a molecular weight of 330.26 g/mol. Its IUPAC name is (4R)-N-hydroxy-2-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-N-hydroxy-2-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11110305 |
| Molecular Formula | C14H13F3N2O4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (4R)-N-hydroxy-2-[4-prop-2-enoxy-3-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | C=CCOc1ccc(C2=N[C@@H](C(=O)NO)CO2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O4/c1-2-5-22-11-4-3-8(6-9(11)14(15,16)17)13-18-10(7-23-13)12(20)19-21/h2-4,6,10,21H,1,5,7H2,(H,19,20)/t10-/m1/s1 |
| InChIKey | IRJRUPACTDBKDZ-SNVBAGLBSA-N |
| XLogP | 1.92 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|