C14H17ClN2O4S — CID 111104870
5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol (PubChem CID 111104870) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol.
| Compound Name | 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol |
|---|---|
| PubChem CID | 111104870 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol |
| SMILES | O=S(=O)(CCCCCO)Cc1noc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H17ClN2O4S/c15-12-6-4-11(5-7-12)14-16-13(17-21-14)10-22(19,20)9-3-1-2-8-18/h4-7,18H,1-3,8-10H2 |
| InChIKey | LASCISZJDKMUJN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|