About 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol
5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol (PubChem CID 111104870) has the molecular formula C14H17ClN2O4S
and a molecular weight of 344.82 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol.
Molecular Properties
| Compound Name | 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol |
| PubChem CID | 111104870 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol |
| SMILES | O=S(=O)(CCCCCO)Cc1noc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H17ClN2O4S/c15-12-6-4-11(5-7-12)14-16-13(17-21-14)10-22(19,20)9-3-1-2-8-18/h4-7,18H,1-3,8-10H2 |
| InChIKey | LASCISZJDKMUJN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol?
The IUPAC name of 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol (CID 111104870) is 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol.
What is the SMILES notation for 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol?
The canonical SMILES for 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol is O=S(=O)(CCCCCO)Cc1noc(-c2ccc(Cl)cc2)n1.
What is the InChIKey of 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol?
The InChIKey is LASCISZJDKMUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN2O4S/c15-12-6-4-11(5-7-12)14-16-13(17-21-14)10-22(19,20)9-3-1-2-8-18/h4-7,18H,1-3,8-10H2.
What are the key properties of 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol?
5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol has a molecular weight of 344.82 g/mol, XLogP of 2.47, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfonyl]pentan-1-ol is sourced from PubChem (CID 111104870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).