C19H30O5 — CID 11110538
5-[(4E,6E)-8-(2-methoxyethoxymethoxy)-3,3-dimethylocta-4,6-dienyl]-3-methylideneoxolan-2-one (PubChem CID 11110538) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is 5-[(4E,6E)-8-(2-methoxyethoxymethoxy)-3,3-dimethylocta-4,6-dienyl]-3-methylideneoxolan-2-one.
| Compound Name | 5-[(4E,6E)-8-(2-methoxyethoxymethoxy)-3,3-dimethylocta-4,6-dienyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 11110538 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 5-[(4E,6E)-8-(2-methoxyethoxymethoxy)-3,3-dimethylocta-4,6-dienyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1CC(CCC(C)(C)/C=C/C=C/COCOCCOC)OC1=O |
| InChI | InChI=1S/C19H30O5/c1-16-14-17(24-18(16)20)8-10-19(2,3)9-6-5-7-11-22-15-23-13-12-21-4/h5-7,9,17H,1,8,10-15H2,2-4H3/b7-5+,9-6+ |
| InChIKey | SKRKMQVMKDOQIS-PDTNFJSOSA-N |
| XLogP | 3.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|