About (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone
(3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone (PubChem CID 11110559) has the molecular formula C13H10F5NO2S
and a molecular weight of 339.29 g/mol. Its IUPAC name is (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone.
Molecular Properties
| Compound Name | (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone |
| PubChem CID | 11110559 |
| Molecular Formula | C13H10F5NO2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone |
| SMILES | O=C(c1ccc(S(F)(F)(F)(F)F)cc1)c1conc1C1CC1 |
| InChI | InChI=1S/C13H10F5NO2S/c14-22(15,16,17,18)10-5-3-9(4-6-10)13(20)11-7-21-19-12(11)8-1-2-8/h3-8H,1-2H2 |
| InChIKey | YUBABRAUFNLLAW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone?
The IUPAC name of (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone (CID 11110559) is (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone.
What is the SMILES notation for (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone?
The canonical SMILES for (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone is O=C(c1ccc(S(F)(F)(F)(F)F)cc1)c1conc1C1CC1.
What is the InChIKey of (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone?
The InChIKey is YUBABRAUFNLLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F5NO2S/c14-22(15,16,17,18)10-5-3-9(4-6-10)13(20)11-7-21-19-12(11)8-1-2-8/h3-8H,1-2H2.
What are the key properties of (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone?
(3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone has a molecular weight of 339.29 g/mol, XLogP of 5.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclopropyl-1,2-oxazol-4-yl)-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanone is sourced from PubChem (CID 11110559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).