About 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile
3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile (PubChem CID 111106087) has the molecular formula C20H29N3O2
and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile |
| PubChem CID | 111106087 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile |
| SMILES | C=CCN(Cc1cccc(C#N)c1)CC(O)CN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C20H29N3O2/c1-4-8-22(13-19-7-5-6-18(9-19)10-21)14-20(24)15-23-11-16(2)25-17(3)12-23/h4-7,9,16-17,20,24H,1,8,11-15H2,2-3H3 |
| InChIKey | KPBKPTUHJHMVAR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile?
The IUPAC name of 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile (CID 111106087) is 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile.
What is the SMILES notation for 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile?
The canonical SMILES for 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile is C=CCN(Cc1cccc(C#N)c1)CC(O)CN1CC(C)OC(C)C1.
What is the InChIKey of 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile?
The InChIKey is KPBKPTUHJHMVAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O2/c1-4-8-22(13-19-7-5-6-18(9-19)10-21)14-20(24)15-23-11-16(2)25-17(3)12-23/h4-7,9,16-17,20,24H,1,8,11-15H2,2-3H3.
What are the key properties of 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile?
3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile has a molecular weight of 343.47 g/mol, XLogP of 2.02, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-prop-2-enylamino]methyl]benzonitrile is sourced from PubChem (CID 111106087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).