About 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile
4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile (PubChem CID 111106098) has the molecular formula C20H31N3O2
and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile |
| PubChem CID | 111106098 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile |
| SMILES | CC1CN(CC(O)CN(Cc2ccc(C#N)cc2)C(C)C)CC(C)O1 |
| InChI | InChI=1S/C20H31N3O2/c1-15(2)23(12-19-7-5-18(9-21)6-8-19)14-20(24)13-22-10-16(3)25-17(4)11-22/h5-8,15-17,20,24H,10-14H2,1-4H3 |
| InChIKey | KXSLVMNRCGSRFI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile?
The IUPAC name of 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile (CID 111106098) is 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile.
What is the SMILES notation for 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile?
The canonical SMILES for 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile is CC1CN(CC(O)CN(Cc2ccc(C#N)cc2)C(C)C)CC(C)O1.
What is the InChIKey of 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile?
The InChIKey is KXSLVMNRCGSRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3O2/c1-15(2)23(12-19-7-5-18(9-21)6-8-19)14-20(24)13-22-10-16(3)25-17(4)11-22/h5-8,15-17,20,24H,10-14H2,1-4H3.
What are the key properties of 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile?
4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile has a molecular weight of 345.49 g/mol, XLogP of 2.24, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[3-(2,6-dimethylmorpholin-4-yl)-2-hydroxypropyl]-propan-2-ylamino]methyl]benzonitrile is sourced from PubChem (CID 111106098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).