About 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile
4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile (PubChem CID 111107293) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile |
| PubChem CID | 111107293 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile |
| SMILES | CC(C)(C)CN(CCCO)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H24N2O/c1-16(2,3)13-18(9-4-10-19)12-15-7-5-14(11-17)6-8-15/h5-8,19H,4,9-10,12-13H2,1-3H3 |
| InChIKey | WVHRATZTOWUUPW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile?
The IUPAC name of 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile (CID 111107293) is 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile.
What is the SMILES notation for 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile?
The canonical SMILES for 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile is CC(C)(C)CN(CCCO)Cc1ccc(C#N)cc1.
What is the InChIKey of 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile?
The InChIKey is WVHRATZTOWUUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-16(2,3)13-18(9-4-10-19)12-15-7-5-14(11-17)6-8-15/h5-8,19H,4,9-10,12-13H2,1-3H3.
What are the key properties of 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile?
4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile has a molecular weight of 260.38 g/mol, XLogP of 2.79, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2,2-dimethylpropyl(3-hydroxypropyl)amino]methyl]benzonitrile is sourced from PubChem (CID 111107293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).