C13H17N3O — CID 11110736
trans-(1R,3R)-N-(diaminomethylidene)-2,2-dimethyl-3-phenylcyclopropane-1-carboxamide (PubChem CID 11110736) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is trans-(1R,3R)-N-(diaminomethylidene)-2,2-dimethyl-3-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-N-(diaminomethylidene)-2,2-dimethyl-3-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11110736 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | trans-(1R,3R)-N-(diaminomethylidene)-2,2-dimethyl-3-phenylcyclopropane-1-carboxamide |
| SMILES | CC1(C)[C@H](C(=O)N=C(N)N)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H17N3O/c1-13(2)9(8-6-4-3-5-7-8)10(13)11(17)16-12(14)15/h3-7,9-10H,1-2H3,(H4,14,15,16,17)/t9-,10+/m1/s1 |
| InChIKey | IFAKNPAXQPARQK-ZJUUUORDSA-N |
| XLogP | 1.23 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|