C20H26O5 — CID 11110772
methyl (5S,8S,9S,10R,13S,14S)-13-methyl-1,7,16-trioxo-2,3,4,5,6,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-10-carboxylate (PubChem CID 11110772) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is methyl (5S,8S,9S,10R,13S,14S)-13-methyl-1,7,16-trioxo-2,3,4,5,6,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-10-carboxylate.
| Compound Name | methyl (5S,8S,9S,10R,13S,14S)-13-methyl-1,7,16-trioxo-2,3,4,5,6,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-10-carboxylate |
|---|---|
| PubChem CID | 11110772 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | methyl (5S,8S,9S,10R,13S,14S)-13-methyl-1,7,16-trioxo-2,3,4,5,6,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-10-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)CCC[C@H]1CC(=O)[C@H]1[C@@H]3CC(=O)C[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C20H26O5/c1-19-7-6-13-17(14(19)9-12(21)10-19)15(22)8-11-4-3-5-16(23)20(11,13)18(24)25-2/h11,13-14,17H,3-10H2,1-2H3/t11-,13-,14-,17+,19-,20+/m0/s1 |
| InChIKey | VPWZRVHQJHYROP-PSLYOXFASA-N |
| XLogP | 2.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|