C17H12F3N3O2 — CID 11110799
(3E)-3-hydroxyimino-5-phenyl-1-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-2-one (PubChem CID 11110799) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is (3E)-3-hydroxyimino-5-phenyl-1-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-2-one.
| Compound Name | (3E)-3-hydroxyimino-5-phenyl-1-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 11110799 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (3E)-3-hydroxyimino-5-phenyl-1-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-2-one |
| SMILES | O=c1/c(=N\O)nc(-c2ccccc2)c2ccccc2n1CC(F)(F)F |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)10-23-13-9-5-4-8-12(13)14(11-6-2-1-3-7-11)21-15(22-25)16(23)24/h1-9,25H,10H2/b22-15+ |
| InChIKey | UBXVVMQQPFVLFE-PXLXIMEGSA-N |
| XLogP | 2.92 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|