C16H12F3N3O2 — CID 111108710
5-cyano-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]pyridine-2-carboxamide (PubChem CID 111108710) has the molecular formula C16H12F3N3O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is 5-cyano-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]pyridine-2-carboxamide.
| Compound Name | 5-cyano-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 111108710 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-cyano-N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]pyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)NCC(O)c2cccc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C16H12F3N3O2/c17-16(18,19)12-3-1-2-11(6-12)14(23)9-22-15(24)13-5-4-10(7-20)8-21-13/h1-6,8,14,23H,9H2,(H,22,24) |
| InChIKey | OKGDKRWUXIZWMO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |