C10H15FIN3O — CID 111108944
2-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111108944) has the molecular formula C10H15FIN3O and a molecular weight of 339.15 g/mol. Its IUPAC name is 2-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111108944 |
| Molecular Formula | C10H15FIN3O |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 2-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COCc1cc(CN=C(N)N)ccc1F.I |
| InChI | InChI=1S/C10H14FN3O.HI/c1-15-6-8-4-7(2-3-9(8)11)5-14-10(12)13;/h2-4H,5-6H2,1H3,(H4,12,13,14);1H |
| InChIKey | RTQNZDQIYYMWDU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|