C19H22FNO2S — CID 111109333
1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-2-(5-methylthiophen-2-yl)ethanone (PubChem CID 111109333) has the molecular formula C19H22FNO2S and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-2-(5-methylthiophen-2-yl)ethanone.
| Compound Name | 1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-2-(5-methylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 111109333 |
| Molecular Formula | C19H22FNO2S |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]-2-(5-methylthiophen-2-yl)ethanone |
| SMILES | Cc1ccc(CC(=O)N2CCC(C(O)c3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C19H22FNO2S/c1-13-2-7-17(24-13)12-18(22)21-10-8-15(9-11-21)19(23)14-3-5-16(20)6-4-14/h2-7,15,19,23H,8-12H2,1H3 |
| InChIKey | SYAXUQXEEJTJJT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |