C20H27N3O2 — CID 111109545
N-(4-hydroxycyclohexyl)-2-(1H-indol-2-yl)piperidine-1-carboxamide (PubChem CID 111109545) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-2-(1H-indol-2-yl)piperidine-1-carboxamide.
| Compound Name | N-(4-hydroxycyclohexyl)-2-(1H-indol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 111109545 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-2-(1H-indol-2-yl)piperidine-1-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)N1CCCCC1c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H27N3O2/c24-16-10-8-15(9-11-16)21-20(25)23-12-4-3-7-19(23)18-13-14-5-1-2-6-17(14)22-18/h1-2,5-6,13,15-16,19,22,24H,3-4,7-12H2,(H,21,25) |
| InChIKey | HFOVQSYTQPRNOW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |