C14H20N6OS2 — CID 11110955
N-[[4-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]acetamide (PubChem CID 11110955) has the molecular formula C14H20N6OS2 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-[[4-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]acetamide.
| Compound Name | N-[[4-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 11110955 |
| Molecular Formula | C14H20N6OS2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-[[4-[2-[(N'-butylcarbamimidoyl)amino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]acetamide |
| SMILES | CCCC/N=C(\N)Nc1nc(-c2csc(CNC(C)=O)n2)cs1 |
| InChI | InChI=1S/C14H20N6OS2/c1-3-4-5-16-13(15)20-14-19-11(8-23-14)10-7-22-12(18-10)6-17-9(2)21/h7-8H,3-6H2,1-2H3,(H,17,21)(H3,15,16,19,20) |
| InChIKey | RZJNVDWUUDYNIM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|