C11H13Cl2F3N2O — CID 111109899
3-[(2,6-dichloro-4-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]propan-1-ol (PubChem CID 111109899) has the molecular formula C11H13Cl2F3N2O and a molecular weight of 317.14 g/mol. Its IUPAC name is 3-[(2,6-dichloro-4-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]propan-1-ol.
| Compound Name | 3-[(2,6-dichloro-4-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 111109899 |
| Molecular Formula | C11H13Cl2F3N2O |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 3-[(2,6-dichloro-4-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]propan-1-ol |
| SMILES | OCCCN(Cc1cc(Cl)nc(Cl)c1)CC(F)(F)F |
| InChI | InChI=1S/C11H13Cl2F3N2O/c12-9-4-8(5-10(13)17-9)6-18(2-1-3-19)7-11(14,15)16/h4-5,19H,1-3,6-7H2 |
| InChIKey | XIEOCMXFZQXPIK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|