C18H25N3O2 — CID 111110263
5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pentan-1-ol (PubChem CID 111110263) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pentan-1-ol.
| Compound Name | 5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 111110263 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 5-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pentan-1-ol |
| SMILES | OCCCCCN1CCCCC1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C18H25N3O2/c22-14-8-2-6-12-21-13-7-5-11-16(21)18-19-17(20-23-18)15-9-3-1-4-10-15/h1,3-4,9-10,16,22H,2,5-8,11-14H2 |
| InChIKey | VLLHMBRINYZHAG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|