About CID 11111053
CID 11111053 (PubChem CID 11111053) has the molecular formula C19H28FeN2O+2
and a molecular weight of 356.29 g/mol.
Molecular Properties
| Compound Name | CID 11111053 |
| PubChem CID | 11111053 |
| Molecular Formula | C19H28FeN2O+2 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | — |
| SMILES | CC[C@@H](NN1CCC[C@H]1COC)[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C14H23N2O.C5H5.Fe/c1-3-14(12-7-4-5-8-12)15-16-10-6-9-13(16)11-17-2;1-2-4-5-3-1;/h4-5,7-8,13-15H,3,6,9-11H2,1-2H3;1-5H;/q;;+2/t13-,14+;;/m0../s1 |
| InChIKey | GJAUYAJFUWDFOC-WICJZZOFSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11111053 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11111053?
The IUPAC name of CID 11111053 (CID 11111053) is not available.
What is the SMILES notation for CID 11111053?
The canonical SMILES for CID 11111053 is CC[C@@H](NN1CCC[C@H]1COC)[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 11111053?
The InChIKey is GJAUYAJFUWDFOC-WICJZZOFSA-N. The full InChI is InChI=1S/C14H23N2O.C5H5.Fe/c1-3-14(12-7-4-5-8-12)15-16-10-6-9-13(16)11-17-2;1-2-4-5-3-1;/h4-5,7-8,13-15H,3,6,9-11H2,1-2H3;1-5H;/q;;+2/t13-,14+;;/m0../s1.
What are the key properties of CID 11111053?
CID 11111053 has a molecular weight of 356.29 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11111053 is sourced from PubChem (CID 11111053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).