About benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate
benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate (PubChem CID 11111067) has the molecular formula C20H24N2O4
and a molecular weight of 356.42 g/mol. Its IUPAC name is benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate.
Molecular Properties
| Compound Name | benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate |
| PubChem CID | 11111067 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate |
| SMILES | O=C([O-])/C=C\C=C/C(=O)[O-].[NH3+]Cc1ccccc1.[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/2C7H9N.C6H6O4/c2*8-6-7-4-2-1-3-5-7;7-5(8)3-1-2-4-6(9)10/h2*1-5H,6,8H2;1-4H,(H,7,8)(H,9,10)/b;;3-1-,4-2- |
| InChIKey | NSGYRAKUQXSURP-IGGOMSPVSA-N |
| XLogP | -1.54 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate?
The IUPAC name of benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate (CID 11111067) is benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate.
What is the SMILES notation for benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate?
The canonical SMILES for benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate is O=C([O-])/C=C\C=C/C(=O)[O-].[NH3+]Cc1ccccc1.[NH3+]Cc1ccccc1.
What is the InChIKey of benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate?
The InChIKey is NSGYRAKUQXSURP-IGGOMSPVSA-N. The full InChI is InChI=1S/2C7H9N.C6H6O4/c2*8-6-7-4-2-1-3-5-7;7-5(8)3-1-2-4-6(9)10/h2*1-5H,6,8H2;1-4H,(H,7,8)(H,9,10)/b;;3-1-,4-2-.
What are the key properties of benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate?
benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate has a molecular weight of 356.42 g/mol, XLogP of -1.54, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzylazanium;(2Z,4Z)-hexa-2,4-dienedioate is sourced from PubChem (CID 11111067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).