C21H28N2O3 — CID 11111074
benzyl N-methyl-N-[(2-methyl-3-oxo-4,5,5a,8,9,9a-hexahydro-1H-2-benzazepin-7-yl)methyl]carbamate (PubChem CID 11111074) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is benzyl N-methyl-N-[(2-methyl-3-oxo-4,5,5a,8,9,9a-hexahydro-1H-2-benzazepin-7-yl)methyl]carbamate.
| Compound Name | benzyl N-methyl-N-[(2-methyl-3-oxo-4,5,5a,8,9,9a-hexahydro-1H-2-benzazepin-7-yl)methyl]carbamate |
|---|---|
| PubChem CID | 11111074 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | benzyl N-methyl-N-[(2-methyl-3-oxo-4,5,5a,8,9,9a-hexahydro-1H-2-benzazepin-7-yl)methyl]carbamate |
| SMILES | CN1CC2CCC(CN(C)C(=O)OCc3ccccc3)=CC2CCC1=O |
| InChI | InChI=1S/C21H28N2O3/c1-22-14-19-9-8-17(12-18(19)10-11-20(22)24)13-23(2)21(25)26-15-16-6-4-3-5-7-16/h3-7,12,18-19H,8-11,13-15H2,1-2H3 |
| InChIKey | HNXLUTHFLVWSQJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|