C18H16N2O3S — CID 111112103
2-N-(2-hydroxy-2-naphthalen-2-ylethyl)thiophene-2,4-dicarboxamide (PubChem CID 111112103) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-N-(2-hydroxy-2-naphthalen-2-ylethyl)thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-(2-hydroxy-2-naphthalen-2-ylethyl)thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 111112103 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-N-(2-hydroxy-2-naphthalen-2-ylethyl)thiophene-2,4-dicarboxamide |
| SMILES | NC(=O)c1csc(C(=O)NCC(O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C18H16N2O3S/c19-17(22)14-8-16(24-10-14)18(23)20-9-15(21)13-6-5-11-3-1-2-4-12(11)7-13/h1-8,10,15,21H,9H2,(H2,19,22)(H,20,23) |
| InChIKey | LZYHXMGCCOGMDF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |