C14H21ClN2O3 — CID 111112461
N-(3-chlorophenyl)-3-[2-hydroxyethyl(3-hydroxypropyl)amino]propanamide (PubChem CID 111112461) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[2-hydroxyethyl(3-hydroxypropyl)amino]propanamide.
| Compound Name | N-(3-chlorophenyl)-3-[2-hydroxyethyl(3-hydroxypropyl)amino]propanamide |
|---|---|
| PubChem CID | 111112461 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-(3-chlorophenyl)-3-[2-hydroxyethyl(3-hydroxypropyl)amino]propanamide |
| SMILES | O=C(CCN(CCO)CCCO)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O3/c15-12-3-1-4-13(11-12)16-14(20)5-7-17(8-10-19)6-2-9-18/h1,3-4,11,18-19H,2,5-10H2,(H,16,20) |
| InChIKey | UJRKPGNBPWNNEU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |