C21H40O3Si — CID 11111398
(2S,6S,9R)-2,6-dimethyl-9-(2-triethylsilyloxypropan-2-yl)cyclodecane-1,5-dione (PubChem CID 11111398) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (2S,6S,9R)-2,6-dimethyl-9-(2-triethylsilyloxypropan-2-yl)cyclodecane-1,5-dione.
| Compound Name | (2S,6S,9R)-2,6-dimethyl-9-(2-triethylsilyloxypropan-2-yl)cyclodecane-1,5-dione |
|---|---|
| PubChem CID | 11111398 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (2S,6S,9R)-2,6-dimethyl-9-(2-triethylsilyloxypropan-2-yl)cyclodecane-1,5-dione |
| SMILES | CC[Si](CC)(CC)OC(C)(C)[C@@H]1CC[C@H](C)C(=O)CC[C@H](C)C(=O)C1 |
| InChI | InChI=1S/C21H40O3Si/c1-8-25(9-2,10-3)24-21(6,7)18-13-11-16(4)19(22)14-12-17(5)20(23)15-18/h16-18H,8-15H2,1-7H3/t16-,17-,18+/m0/s1 |
| InChIKey | BIZHOXSJEWWOAS-OKZBNKHCSA-N |
| XLogP | 5.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|