C20H39NO3Si — CID 11111423
ethyl (2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-4-(dimethylamino)-2,6-dimethylocta-2,6-dienoate (PubChem CID 11111423) has the molecular formula C20H39NO3Si and a molecular weight of 369.62 g/mol. Its IUPAC name is ethyl (2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-4-(dimethylamino)-2,6-dimethylocta-2,6-dienoate.
| Compound Name | ethyl (2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-4-(dimethylamino)-2,6-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 11111423 |
| Molecular Formula | C20H39NO3Si |
| Molecular Weight | 369.62 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | ethyl (2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-4-(dimethylamino)-2,6-dimethylocta-2,6-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C(C/C(C)=C/CO[Si](C)(C)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C20H39NO3Si/c1-11-23-19(22)17(3)15-18(21(7)8)14-16(2)12-13-24-25(9,10)20(4,5)6/h12,15,18H,11,13-14H2,1-10H3/b16-12+,17-15+ |
| InChIKey | OZPBRSSSBNZBOU-HTJJBPINSA-N |
| XLogP | 4.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|