C22H18N4O2 — CID 11111444
12-benzoyl-4-phenyl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one (PubChem CID 11111444) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 12-benzoyl-4-phenyl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one.
| Compound Name | 12-benzoyl-4-phenyl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
|---|---|
| PubChem CID | 11111444 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 12-benzoyl-4-phenyl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
| SMILES | O=C(c1ccccc1)N1CCc2[nH]c(=O)n3cc(-c4ccccc4)nc3c2C1 |
| InChI | InChI=1S/C22H18N4O2/c27-21(16-9-5-2-6-10-16)25-12-11-18-17(13-25)20-23-19(14-26(20)22(28)24-18)15-7-3-1-4-8-15/h1-10,14H,11-13H2,(H,24,28) |
| InChIKey | NVVJSVGOYNWJOY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |