About diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate
diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate (PubChem CID 11111455) has the molecular formula C19H34O5Si
and a molecular weight of 370.56 g/mol. Its IUPAC name is diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate |
| PubChem CID | 11111455 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1C=C[C@@H](CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H34O5Si/c1-8-22-17(20)16(18(21)23-9-2)15-11-10-14(12-15)13-24-25(6,7)19(3,4)5/h10-11,14-16H,8-9,12-13H2,1-7H3/t14-,15-/m1/s1 |
| InChIKey | AEXCQUXKVWRCOY-HUUCEWRRSA-N |
| XLogP | 3.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate?
The IUPAC name of diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate (CID 11111455) is diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate.
What is the SMILES notation for diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate?
The canonical SMILES for diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate is CCOC(=O)C(C(=O)OCC)[C@@H]1C=C[C@@H](CO[Si](C)(C)C(C)(C)C)C1.
What is the InChIKey of diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate?
The InChIKey is AEXCQUXKVWRCOY-HUUCEWRRSA-N. The full InChI is InChI=1S/C19H34O5Si/c1-8-22-17(20)16(18(21)23-9-2)15-11-10-14(12-15)13-24-25(6,7)19(3,4)5/h10-11,14-16H,8-9,12-13H2,1-7H3/t14-,15-/m1/s1.
What are the key properties of diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate?
diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate has a molecular weight of 370.56 g/mol, XLogP of 3.94, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(1S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-yl]propanedioate is sourced from PubChem (CID 11111455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).