C23H30N2O3 — CID 11111741
(1R,2S,6R,7S)-3-[(E,3S)-3-hydroxyhex-4-enoyl]-1,10,10-trimethyl-5-phenyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 11111741) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is (1R,2S,6R,7S)-3-[(E,3S)-3-hydroxyhex-4-enoyl]-1,10,10-trimethyl-5-phenyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | (1R,2S,6R,7S)-3-[(E,3S)-3-hydroxyhex-4-enoyl]-1,10,10-trimethyl-5-phenyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 11111741 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (1R,2S,6R,7S)-3-[(E,3S)-3-hydroxyhex-4-enoyl]-1,10,10-trimethyl-5-phenyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | C/C=C/[C@@H](O)CC(=O)N1C(=O)N(c2ccccc2)[C@@H]2[C@H]3CC[C@@](C)([C@@H]21)C3(C)C |
| InChI | InChI=1S/C23H30N2O3/c1-5-9-16(26)14-18(27)25-20-19(17-12-13-23(20,4)22(17,2)3)24(21(25)28)15-10-7-6-8-11-15/h5-11,16-17,19-20,26H,12-14H2,1-4H3/b9-5+/t16-,17-,19-,20-,23+/m1/s1 |
| InChIKey | YGFGDLMCAQVLDY-VFJIILRDSA-N |
| XLogP | 3.98 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|