C14H16N2O2S2 — CID 111118283
N-(4-hydroxycyclohexyl)-2-thiophen-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 111118283) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-2-thiophen-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-hydroxycyclohexyl)-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111118283 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)c1cnc(-c2ccsc2)s1 |
| InChI | InChI=1S/C14H16N2O2S2/c17-11-3-1-10(2-4-11)16-13(18)12-7-15-14(20-12)9-5-6-19-8-9/h5-8,10-11,17H,1-4H2,(H,16,18) |
| InChIKey | KDVRPQNNQUFPDB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |