C13H20N2O3 — CID 111119239
3,3-dimethyl-1-[(4-nitrophenyl)methylamino]butan-2-ol (PubChem CID 111119239) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(4-nitrophenyl)methylamino]butan-2-ol.
| Compound Name | 3,3-dimethyl-1-[(4-nitrophenyl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 111119239 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3,3-dimethyl-1-[(4-nitrophenyl)methylamino]butan-2-ol |
| SMILES | CC(C)(C)C(O)CNCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H20N2O3/c1-13(2,3)12(16)9-14-8-10-4-6-11(7-5-10)15(17)18/h4-7,12,14,16H,8-9H2,1-3H3 |
| InChIKey | YRSFURCVJUFPFZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|