C23H40O3Si — CID 11111980
ethyl (2E,4E)-5-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienoate (PubChem CID 11111980) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 11111980 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | ethyl (2E,4E)-5-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C1=C(C)C[C@@H](O[Si](C)(C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C23H40O3Si/c1-11-25-21(24)14-17(2)12-13-20-18(3)15-19(16-23(20,7)8)26-27(9,10)22(4,5)6/h12-14,19H,11,15-16H2,1-10H3/b13-12+,17-14+/t19-/m1/s1 |
| InChIKey | MMZCEKKFNABTOM-IFXNCWKVSA-N |
| XLogP | 6.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|