C13H19BrN2O2 — CID 111120348
1-(2-bromophenyl)-3-(2-hydroxy-2,3-dimethylbutyl)urea (PubChem CID 111120348) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(2-hydroxy-2,3-dimethylbutyl)urea.
| Compound Name | 1-(2-bromophenyl)-3-(2-hydroxy-2,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111120348 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-(2-bromophenyl)-3-(2-hydroxy-2,3-dimethylbutyl)urea |
| SMILES | CC(C)C(C)(O)CNC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C13H19BrN2O2/c1-9(2)13(3,18)8-15-12(17)16-11-7-5-4-6-10(11)14/h4-7,9,18H,8H2,1-3H3,(H2,15,16,17) |
| InChIKey | VSENHSZCUXRTRC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |