C22H40O4Si — CID 11112071
(1R,2S,3aS,5S,6S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1-[(2-methylpropan-2-yl)oxy]-8-oxo-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene-2-carbaldehyde (PubChem CID 11112071) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is (1R,2S,3aS,5S,6S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1-[(2-methylpropan-2-yl)oxy]-8-oxo-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene-2-carbaldehyde.
| Compound Name | (1R,2S,3aS,5S,6S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1-[(2-methylpropan-2-yl)oxy]-8-oxo-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene-2-carbaldehyde |
|---|---|
| PubChem CID | 11112071 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (1R,2S,3aS,5S,6S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1-[(2-methylpropan-2-yl)oxy]-8-oxo-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene-2-carbaldehyde |
| SMILES | C[C@H]1CC(=O)[C@@H]2[C@H](C[C@@H]1O[Si](C)(C)C(C)(C)C)C[C@H](C=O)[C@H]2OC(C)(C)C |
| InChI | InChI=1S/C22H40O4Si/c1-14-10-17(24)19-15(11-16(13-23)20(19)25-21(2,3)4)12-18(14)26-27(8,9)22(5,6)7/h13-16,18-20H,10-12H2,1-9H3/t14-,15-,16+,18-,19-,20+/m0/s1 |
| InChIKey | MQZWMTWDRAGCJF-JFVPRCSHSA-N |
| XLogP | 5.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|