C15H14ClFN2O8 — CID 11112250
(4S,5R)-5-(3-chloro-4-fluoro-5-nitrophenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-oxazolidine-4-carboxylic acid (PubChem CID 11112250) has the molecular formula C15H14ClFN2O8 and a molecular weight of 404.73 g/mol. Its IUPAC name is (4S,5R)-5-(3-chloro-4-fluoro-5-nitrophenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-oxazolidine-4-carboxylic acid.
| Compound Name | (4S,5R)-5-(3-chloro-4-fluoro-5-nitrophenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-oxazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 11112250 |
| Molecular Formula | C15H14ClFN2O8 |
| Molecular Weight | 404.73 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | (4S,5R)-5-(3-chloro-4-fluoro-5-nitrophenyl)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-oxazolidine-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C(=O)O[C@H](c2cc(Cl)c(F)c([N+](=O)[O-])c2)[C@H]1C(=O)O |
| InChI | InChI=1S/C15H14ClFN2O8/c1-15(2,3)27-14(23)18-10(12(20)21)11(26-13(18)22)6-4-7(16)9(17)8(5-6)19(24)25/h4-5,10-11H,1-3H3,(H,20,21)/t10-,11+/m0/s1 |
| InChIKey | KLCCLZHTBOKTOB-WDEREUQCSA-N |
| XLogP | 3.27 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|