C20H27BrN2O2 — CID 11112297
(2-benzyl-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl-trimethylazanium bromide (PubChem CID 11112297) has the molecular formula C20H27BrN2O2 and a molecular weight of 407.35 g/mol. Its IUPAC name is (2-benzyl-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl-trimethylazanium bromide.
| Compound Name | (2-benzyl-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 11112297 |
| Molecular Formula | C20H27BrN2O2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2-benzyl-7-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl-trimethylazanium bromide |
| SMILES | CC1C=CC(C[N+](C)(C)C)C2C(=O)N(Cc3ccccc3)C(=O)C12.[Br-] |
| InChI | InChI=1S/C20H27N2O2.BrH/c1-14-10-11-16(13-22(2,3)4)18-17(14)19(23)21(20(18)24)12-15-8-6-5-7-9-15;/h5-11,14,16-18H,12-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NSLSIGLMJOQRQG-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|