C15H23NO3 — CID 111123240
(3S)-1-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]pyrrolidin-3-ol (PubChem CID 111123240) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (3S)-1-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 111123240 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (3S)-1-[3-(2,5-dimethylphenoxy)-2-hydroxypropyl]pyrrolidin-3-ol |
| SMILES | Cc1ccc(C)c(OCC(O)CN2CC[C@H](O)C2)c1 |
| InChI | InChI=1S/C15H23NO3/c1-11-3-4-12(2)15(7-11)19-10-14(18)9-16-6-5-13(17)8-16/h3-4,7,13-14,17-18H,5-6,8-10H2,1-2H3/t13-,14?/m0/s1 |
| InChIKey | PGDFADZUSHQGHN-LSLKUGRBSA-N |
| XLogP | 1.11 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |