C12H20N4O2 — CID 111123829
N-(furan-2-ylmethyl)-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]acetamide (PubChem CID 111123829) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]acetamide |
|---|---|
| PubChem CID | 111123829 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]acetamide |
| SMILES | C/N=C(/NCC(=O)NCc1ccco1)NC(C)C |
| InChI | InChI=1S/C12H20N4O2/c1-9(2)16-12(13-3)15-8-11(17)14-7-10-5-4-6-18-10/h4-6,9H,7-8H2,1-3H3,(H,14,17)(H2,13,15,16) |
| InChIKey | DHDLAJYCXLKUTF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|