C28H33NO2 — CID 11112475
(8R,9S,13S,14S,16Z)-16-[[4-(dimethylamino)phenyl]methylidene]-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one (PubChem CID 11112475) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (8R,9S,13S,14S,16Z)-16-[[4-(dimethylamino)phenyl]methylidene]-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,16Z)-16-[[4-(dimethylamino)phenyl]methylidene]-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11112475 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (8R,9S,13S,14S,16Z)-16-[[4-(dimethylamino)phenyl]methylidene]-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)/C(=C\c3ccc(N(C)C)cc3)C[C@@H]12 |
| InChI | InChI=1S/C28H33NO2/c1-28-14-13-24-23-12-10-22(31-4)16-19(23)7-11-25(24)26(28)17-20(27(28)30)15-18-5-8-21(9-6-18)29(2)3/h5-6,8-10,12,15-16,24-26H,7,11,13-14,17H2,1-4H3/b20-15-/t24-,25-,26+,28+/m1/s1 |
| InChIKey | LDMKWZWZDAKONI-ISMOPVKBSA-N |
| XLogP | 5.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|