C16H27IN4O — CID 111124820
N-ethyl-4-[[[ethylamino-(propan-2-ylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111124820) has the molecular formula C16H27IN4O and a molecular weight of 418.32 g/mol. Its IUPAC name is N-ethyl-4-[[[ethylamino-(propan-2-ylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-ethyl-4-[[[ethylamino-(propan-2-ylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111124820 |
| Molecular Formula | C16H27IN4O |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-ethyl-4-[[[ethylamino-(propan-2-ylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCNC(=O)c1ccc(C/N=C(\NCC)NC(C)C)cc1.I |
| InChI | InChI=1S/C16H26N4O.HI/c1-5-17-15(21)14-9-7-13(8-10-14)11-19-16(18-6-2)20-12(3)4;/h7-10,12H,5-6,11H2,1-4H3,(H,17,21)(H2,18,19,20);1H |
| InChIKey | KQDABNYBUQVGLZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|