C30H52O — CID 11112780
cis-(1S,2S)-1,3,3-trimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexan-1-ol (PubChem CID 11112780) has the molecular formula C30H52O and a molecular weight of 428.75 g/mol. Its IUPAC name is cis-(1S,2S)-1,3,3-trimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-1,3,3-trimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11112780 |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.40 |
| IUPAC Name | cis-(1S,2S)-1,3,3-trimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC[C@H]1C(C)(C)CCC[C@]1(C)O |
| InChI | InChI=1S/C30H52O/c1-24(2)14-11-17-26(4)19-12-18-25(3)15-9-10-16-27(5)20-21-28-29(6,7)22-13-23-30(28,8)31/h14-16,19,28,31H,9-13,17-18,20-23H2,1-8H3/b25-15+,26-19+,27-16+/t28-,30-/m0/s1 |
| InChIKey | DGOKWAFQPVKPJR-AYXNWFOZSA-N |
| XLogP | 9.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|