C15H16O4S — CID 11112826
methyl 2-[6-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]acetate (PubChem CID 11112826) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is methyl 2-[6-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]acetate.
| Compound Name | methyl 2-[6-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]acetate |
|---|---|
| PubChem CID | 11112826 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | methyl 2-[6-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]acetate |
| SMILES | COC(=O)CC1C=CC=CC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H16O4S/c1-19-15(16)11-12-7-5-6-10-14(12)20(17,18)13-8-3-2-4-9-13/h2-10,12,14H,11H2,1H3 |
| InChIKey | SDIPPJZUYHSMSV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |